C20H26 — CID 15351281
(2R,3R,6S,7S,9R,10R,13S,14S)-hexacyclo[6.6.2.23,6.210,13.02,7.09,14]icosa-4,11-diene (PubChem CID 15351281) has the molecular formula C20H26 and a molecular weight of 266.43 g/mol. Its IUPAC name is (2R,3R,6S,7S,9R,10R,13S,14S)-hexacyclo[6.6.2.23,6.210,13.02,7.09,14]icosa-4,11-diene.
| Compound Name | (2R,3R,6S,7S,9R,10R,13S,14S)-hexacyclo[6.6.2.23,6.210,13.02,7.09,14]icosa-4,11-diene |
|---|---|
| PubChem CID | 15351281 |
| Molecular Formula | C20H26 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | (2R,3R,6S,7S,9R,10R,13S,14S)-hexacyclo[6.6.2.23,6.210,13.02,7.09,14]icosa-4,11-diene |
| SMILES | C1=C[C@H]2CC[C@@H]1[C@H]1C3CCC([C@H]12)[C@H]1[C@@H]3[C@H]2C=C[C@@H]1CC2 |
| InChI | InChI=1S/C20H26/c1-2-12-4-3-11(1)17-15-9-10-16(18(12)17)20-14-7-5-13(6-8-14)19(15)20/h1-2,5,7,11-20H,3-4,6,8-10H2/t11-,12+,13+,14-,15?,16?,17+,18-,19-,20+ |
| InChIKey | YXHZXCNXHUDSAY-ADKOFPOVSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|