C20H13Cl2N3O3Se — CID 15351479
5',7'-bis(4-chlorophenyl)spiro[1,2-oxazolidine-4,6'-5,7-dihydro-4H-1,2,3-benzoselenadiazole]-3,5-dione (PubChem CID 15351479) has the molecular formula C20H13Cl2N3O3Se and a molecular weight of 493.21 g/mol. Its IUPAC name is 5',7'-bis(4-chlorophenyl)spiro[1,2-oxazolidine-4,6'-5,7-dihydro-4H-1,2,3-benzoselenadiazole]-3,5-dione.
| Compound Name | 5',7'-bis(4-chlorophenyl)spiro[1,2-oxazolidine-4,6'-5,7-dihydro-4H-1,2,3-benzoselenadiazole]-3,5-dione |
|---|---|
| PubChem CID | 15351479 |
| Molecular Formula | C20H13Cl2N3O3Se |
| Molecular Weight | 493.21 g/mol |
| Exact Mass | 492.95 |
| IUPAC Name | 5',7'-bis(4-chlorophenyl)spiro[1,2-oxazolidine-4,6'-5,7-dihydro-4H-1,2,3-benzoselenadiazole]-3,5-dione |
| SMILES | O=C1NOC(=O)C12C(c1ccc(Cl)cc1)Cc1nn[se]c1C2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H13Cl2N3O3Se/c21-12-5-1-10(2-6-12)14-9-15-17(29-25-23-15)16(11-3-7-13(22)8-4-11)20(14)18(26)24-28-19(20)27/h1-8,14,16H,9H2,(H,24,26) |
| InChIKey | VRRHZUXUMDMEPG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.21 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|