C20H28O2Si — CID 15351913
(2S,5Z,9S)-9-[tert-butyl(dimethyl)silyl]oxy-12-methylbicyclo[7.3.1]trideca-1(12),5-dien-3,7-diyn-2-ol (PubChem CID 15351913) has the molecular formula C20H28O2Si and a molecular weight of 328.53 g/mol. Its IUPAC name is (2S,5Z,9S)-9-[tert-butyl(dimethyl)silyl]oxy-12-methylbicyclo[7.3.1]trideca-1(12),5-dien-3,7-diyn-2-ol.
| Compound Name | (2S,5Z,9S)-9-[tert-butyl(dimethyl)silyl]oxy-12-methylbicyclo[7.3.1]trideca-1(12),5-dien-3,7-diyn-2-ol |
|---|---|
| PubChem CID | 15351913 |
| Molecular Formula | C20H28O2Si |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (2S,5Z,9S)-9-[tert-butyl(dimethyl)silyl]oxy-12-methylbicyclo[7.3.1]trideca-1(12),5-dien-3,7-diyn-2-ol |
| SMILES | CC1=C2C[C@](O[Si](C)(C)C(C)(C)C)(C#C/C=C\C#C[C@@H]2O)CC1 |
| InChI | InChI=1S/C20H28O2Si/c1-16-12-14-20(22-23(5,6)19(2,3)4)13-10-8-7-9-11-18(21)17(16)15-20/h7-8,18,21H,12,14-15H2,1-6H3/b8-7-/t18-,20-/m0/s1 |
| InChIKey | HRZBLDBSMGAQFB-LGYYHMKYSA-N |
| XLogP | 4.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|