About (E)-1,2-bis(1-adamantyl)-2-methylsulfanylethenethiol
(E)-1,2-bis(1-adamantyl)-2-methylsulfanylethenethiol (PubChem CID 15352068) has the molecular formula C23H34S2
and a molecular weight of 374.66 g/mol. Its IUPAC name is (E)-1,2-bis(1-adamantyl)-2-methylsulfanylethenethiol.
Molecular Properties
| Compound Name | (E)-1,2-bis(1-adamantyl)-2-methylsulfanylethenethiol |
| PubChem CID | 15352068 |
| Molecular Formula | C23H34S2 |
| Molecular Weight | 374.66 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (E)-1,2-bis(1-adamantyl)-2-methylsulfanylethenethiol |
| SMILES | CS/C(=C(/S)C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H34S2/c1-25-21(23-11-17-5-18(12-23)7-19(6-17)13-23)20(24)22-8-14-2-15(9-22)4-16(3-14)10-22/h14-19,24H,2-13H2,1H3/b21-20+ |
| InChIKey | LDVGGUMHCUKSKQ-QZQOTICOSA-N |
| XLogP | 6.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.66 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,2-bis(1-adamantyl)-2-methylsulfanylethenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,2-bis(1-adamantyl)-2-methylsulfanylethenethiol?
The IUPAC name of (E)-1,2-bis(1-adamantyl)-2-methylsulfanylethenethiol (CID 15352068) is (E)-1,2-bis(1-adamantyl)-2-methylsulfanylethenethiol.
What is the SMILES notation for (E)-1,2-bis(1-adamantyl)-2-methylsulfanylethenethiol?
The canonical SMILES for (E)-1,2-bis(1-adamantyl)-2-methylsulfanylethenethiol is CS/C(=C(/S)C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of (E)-1,2-bis(1-adamantyl)-2-methylsulfanylethenethiol?
The InChIKey is LDVGGUMHCUKSKQ-QZQOTICOSA-N. The full InChI is InChI=1S/C23H34S2/c1-25-21(23-11-17-5-18(12-23)7-19(6-17)13-23)20(24)22-8-14-2-15(9-22)4-16(3-14)10-22/h14-19,24H,2-13H2,1H3/b21-20+.
What are the key properties of (E)-1,2-bis(1-adamantyl)-2-methylsulfanylethenethiol?
(E)-1,2-bis(1-adamantyl)-2-methylsulfanylethenethiol has a molecular weight of 374.66 g/mol, XLogP of 6.92, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,2-bis(1-adamantyl)-2-methylsulfanylethenethiol is sourced from PubChem (CID 15352068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).