About 4,5-bis(1-adamantyl)trithiole 2-oxide
4,5-bis(1-adamantyl)trithiole 2-oxide (PubChem CID 15352071) has the molecular formula C22H30OS3
and a molecular weight of 406.68 g/mol. Its IUPAC name is 4,5-bis(1-adamantyl)trithiole 2-oxide.
Molecular Properties
| Compound Name | 4,5-bis(1-adamantyl)trithiole 2-oxide |
| PubChem CID | 15352071 |
| Molecular Formula | C22H30OS3 |
| Molecular Weight | 406.68 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 4,5-bis(1-adamantyl)trithiole 2-oxide |
| SMILES | O=S1SC(C23CC4CC(CC(C4)C2)C3)=C(C23CC4CC(CC(C4)C2)C3)S1 |
| InChI | InChI=1S/C22H30OS3/c23-26-24-19(21-7-13-1-14(8-21)3-15(2-13)9-21)20(25-26)22-10-16-4-17(11-22)6-18(5-16)12-22/h13-18H,1-12H2 |
| InChIKey | XZDXYMVZPOFOGP-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.68 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 4,5-bis(1-adamantyl)trithiole 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(1-adamantyl)trithiole 2-oxide?
The IUPAC name of 4,5-bis(1-adamantyl)trithiole 2-oxide (CID 15352071) is 4,5-bis(1-adamantyl)trithiole 2-oxide.
What is the SMILES notation for 4,5-bis(1-adamantyl)trithiole 2-oxide?
The canonical SMILES for 4,5-bis(1-adamantyl)trithiole 2-oxide is O=S1SC(C23CC4CC(CC(C4)C2)C3)=C(C23CC4CC(CC(C4)C2)C3)S1.
What is the InChIKey of 4,5-bis(1-adamantyl)trithiole 2-oxide?
The InChIKey is XZDXYMVZPOFOGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30OS3/c23-26-24-19(21-7-13-1-14(8-21)3-15(2-13)9-21)20(25-26)22-10-16-4-17(11-22)6-18(5-16)12-22/h13-18H,1-12H2.
What are the key properties of 4,5-bis(1-adamantyl)trithiole 2-oxide?
4,5-bis(1-adamantyl)trithiole 2-oxide has a molecular weight of 406.68 g/mol, XLogP of 6.69, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(1-adamantyl)trithiole 2-oxide is sourced from PubChem (CID 15352071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).