C47H26F6 — CID 15352417
4-[2-[3,4-bis(2-phenylethynyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,2-bis(2-phenylethynyl)benzene (PubChem CID 15352417) has the molecular formula C47H26F6 and a molecular weight of 704.71 g/mol. Its IUPAC name is 4-[2-[3,4-bis(2-phenylethynyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,2-bis(2-phenylethynyl)benzene.
| Compound Name | 4-[2-[3,4-bis(2-phenylethynyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,2-bis(2-phenylethynyl)benzene |
|---|---|
| PubChem CID | 15352417 |
| Molecular Formula | C47H26F6 |
| Molecular Weight | 704.71 g/mol |
| Exact Mass | 704.19 |
| IUPAC Name | 4-[2-[3,4-bis(2-phenylethynyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,2-bis(2-phenylethynyl)benzene |
| SMILES | FC(F)(F)C(c1ccc(C#Cc2ccccc2)c(C#Cc2ccccc2)c1)(c1ccc(C#Cc2ccccc2)c(C#Cc2ccccc2)c1)C(F)(F)F |
| InChI | InChI=1S/C47H26F6/c48-46(49,50)45(47(51,52)53,43-31-29-39(25-21-35-13-5-1-6-14-35)41(33-43)27-23-37-17-9-3-10-18-37)44-32-30-40(26-22-36-15-7-2-8-16-36)42(34-44)28-24-38-19-11-4-12-20-38/h1-20,29-34H |
| InChIKey | PBLVCWAIYDFCGP-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.71 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|