C20H21NO — CID 15352468
(1R,5R,7S)-6,7-diphenyl-6-azabicyclo[3.2.2]nonan-8-one (PubChem CID 15352468) has the molecular formula C20H21NO and a molecular weight of 291.39 g/mol. Its IUPAC name is (1R,5R,7S)-6,7-diphenyl-6-azabicyclo[3.2.2]nonan-8-one.
| Compound Name | (1R,5R,7S)-6,7-diphenyl-6-azabicyclo[3.2.2]nonan-8-one |
|---|---|
| PubChem CID | 15352468 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (1R,5R,7S)-6,7-diphenyl-6-azabicyclo[3.2.2]nonan-8-one |
| SMILES | O=C1C[C@H]2CCC[C@@H]1[C@@H](c1ccccc1)N2c1ccccc1 |
| InChI | InChI=1S/C20H21NO/c22-19-14-17-12-7-13-18(19)20(15-8-3-1-4-9-15)21(17)16-10-5-2-6-11-16/h1-6,8-11,17-18,20H,7,12-14H2/t17-,18+,20-/m1/s1 |
| InChIKey | VZIBNTPQGBFLTK-WSTZPKSXSA-N |
| XLogP | 4.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |