C8H6ClNOS2 — CID 15352476
4-chloro-5,7-dimethyl-1,2,3-benzodithiazol-6-one (PubChem CID 15352476) has the molecular formula C8H6ClNOS2 and a molecular weight of 231.73 g/mol. Its IUPAC name is 4-chloro-5,7-dimethyl-1,2,3-benzodithiazol-6-one.
| Compound Name | 4-chloro-5,7-dimethyl-1,2,3-benzodithiazol-6-one |
|---|---|
| PubChem CID | 15352476 |
| Molecular Formula | C8H6ClNOS2 |
| Molecular Weight | 231.73 g/mol |
| Exact Mass | 230.96 |
| IUPAC Name | 4-chloro-5,7-dimethyl-1,2,3-benzodithiazol-6-one |
| SMILES | Cc1c2ssnc-2c(Cl)c(C)c1=O |
| InChI | InChI=1S/C8H6ClNOS2/c1-3-5(9)6-8(12-13-10-6)4(2)7(3)11/h1-2H3 |
| InChIKey | CMLYPRGABQWIGQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.73 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |