C21H20O5 — CID 15352566
(3E,5Z)-3-methoxycarbonyl-6-(4-methoxyphenyl)-5-phenylhexa-3,5-dienoic acid (PubChem CID 15352566) has the molecular formula C21H20O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is (3E,5Z)-3-methoxycarbonyl-6-(4-methoxyphenyl)-5-phenylhexa-3,5-dienoic acid.
| Compound Name | (3E,5Z)-3-methoxycarbonyl-6-(4-methoxyphenyl)-5-phenylhexa-3,5-dienoic acid |
|---|---|
| PubChem CID | 15352566 |
| Molecular Formula | C21H20O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | (3E,5Z)-3-methoxycarbonyl-6-(4-methoxyphenyl)-5-phenylhexa-3,5-dienoic acid |
| SMILES | COC(=O)/C(=C/C(=C/c1ccc(OC)cc1)c1ccccc1)CC(=O)O |
| InChI | InChI=1S/C21H20O5/c1-25-19-10-8-15(9-11-19)12-17(16-6-4-3-5-7-16)13-18(14-20(22)23)21(24)26-2/h3-13H,14H2,1-2H3,(H,22,23)/b17-12-,18-13+ |
| InChIKey | DCPQICGIYVKLTP-BQWARBPISA-N |
| XLogP | 3.81 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|