C32H35NO6 — CID 15352804
dimethyl (2S,3S,4S,5S)-1-[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-2,5-diphenylpyrrolidine-3,4-dicarboxylate (PubChem CID 15352804) has the molecular formula C32H35NO6 and a molecular weight of 529.63 g/mol. Its IUPAC name is dimethyl (2S,3S,4S,5S)-1-[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-2,5-diphenylpyrrolidine-3,4-dicarboxylate.
| Compound Name | dimethyl (2S,3S,4S,5S)-1-[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-2,5-diphenylpyrrolidine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 15352804 |
| Molecular Formula | C32H35NO6 |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | dimethyl (2S,3S,4S,5S)-1-[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-2,5-diphenylpyrrolidine-3,4-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@H](C(=O)OC)[C@@H](c2ccccc2)N([C@H]2COC(C)(C)O[C@H]2c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C32H35NO6/c1-32(2)38-20-24(29(39-32)23-18-12-7-13-19-23)33-27(21-14-8-5-9-15-21)25(30(34)36-3)26(31(35)37-4)28(33)22-16-10-6-11-17-22/h5-19,24-29H,20H2,1-4H3/t24-,25-,26-,27+,28+,29-/m0/s1 |
| InChIKey | MPQRGGBNWKXJJB-AAVBVRJXSA-N |
| XLogP | 5.26 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |