C32H31FN2O6 — CID 15352806
methyl (1S,3S,3aS,6aR)-2-[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-1-(4-fluorophenyl)-4,6-dioxo-5-phenyl-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 15352806) has the molecular formula C32H31FN2O6 and a molecular weight of 558.61 g/mol. Its IUPAC name is methyl (1S,3S,3aS,6aR)-2-[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-1-(4-fluorophenyl)-4,6-dioxo-5-phenyl-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl (1S,3S,3aS,6aR)-2-[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-1-(4-fluorophenyl)-4,6-dioxo-5-phenyl-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 15352806 |
| Molecular Formula | C32H31FN2O6 |
| Molecular Weight | 558.61 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | methyl (1S,3S,3aS,6aR)-2-[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-1-(4-fluorophenyl)-4,6-dioxo-5-phenyl-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2C(=O)N(c3ccccc3)C(=O)[C@H]2[C@@H](c2ccc(F)cc2)N1[C@H]1COC(C)(C)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C32H31FN2O6/c1-32(2)40-18-23(28(41-32)20-10-6-4-7-11-20)35-26(19-14-16-21(33)17-15-19)24-25(27(35)31(38)39-3)30(37)34(29(24)36)22-12-8-5-9-13-22/h4-17,23-28H,18H2,1-3H3/t23-,24+,25-,26+,27-,28-/m0/s1 |
| InChIKey | YNURUDGRNYMSLT-PJOBXVJWSA-N |
| XLogP | 4.42 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.61 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|