C18H22O2 — CID 15352878
(4aS,5S)-4a-methyl-5-phenylmethoxy-3,4,5,6,7,8-hexahydronaphthalen-2-one (PubChem CID 15352878) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is (4aS,5S)-4a-methyl-5-phenylmethoxy-3,4,5,6,7,8-hexahydronaphthalen-2-one.
| Compound Name | (4aS,5S)-4a-methyl-5-phenylmethoxy-3,4,5,6,7,8-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 15352878 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (4aS,5S)-4a-methyl-5-phenylmethoxy-3,4,5,6,7,8-hexahydronaphthalen-2-one |
| SMILES | C[C@]12CCC(=O)C=C1CCC[C@@H]2OCc1ccccc1 |
| InChI | InChI=1S/C18H22O2/c1-18-11-10-16(19)12-15(18)8-5-9-17(18)20-13-14-6-3-2-4-7-14/h2-4,6-7,12,17H,5,8-11,13H2,1H3/t17-,18-/m0/s1 |
| InChIKey | BDRYNRZIXCMESC-ROUUACIJSA-N |
| XLogP | 4.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |