C11H20O2 — CID 15353102
(1S,2S,5S,6R)-2-(hydroxymethyl)-5-methyl-6-propylcyclohex-3-en-1-ol (PubChem CID 15353102) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (1S,2S,5S,6R)-2-(hydroxymethyl)-5-methyl-6-propylcyclohex-3-en-1-ol.
| Compound Name | (1S,2S,5S,6R)-2-(hydroxymethyl)-5-methyl-6-propylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 15353102 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (1S,2S,5S,6R)-2-(hydroxymethyl)-5-methyl-6-propylcyclohex-3-en-1-ol |
| SMILES | CCC[C@H]1[C@H](O)[C@H](CO)C=C[C@@H]1C |
| InChI | InChI=1S/C11H20O2/c1-3-4-10-8(2)5-6-9(7-12)11(10)13/h5-6,8-13H,3-4,7H2,1-2H3/t8-,9-,10+,11+/m0/s1 |
| InChIKey | PFCOYMJQSHIEGB-UKKRHICBSA-N |
| XLogP | 1.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|