About 1-cyclohepta-1,3,5-trien-1-yl-3-methoxypropan-1-one
1-cyclohepta-1,3,5-trien-1-yl-3-methoxypropan-1-one (PubChem CID 15353171) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 1-cyclohepta-1,3,5-trien-1-yl-3-methoxypropan-1-one.
Molecular Properties
| Compound Name | 1-cyclohepta-1,3,5-trien-1-yl-3-methoxypropan-1-one |
| PubChem CID | 15353171 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 1-cyclohepta-1,3,5-trien-1-yl-3-methoxypropan-1-one |
| SMILES | COCCC(=O)C1=CC=CC=CC1 |
| InChI | InChI=1S/C11H14O2/c1-13-9-8-11(12)10-6-4-2-3-5-7-10/h2-6H,7-9H2,1H3 |
| InChIKey | JAQHNCUYRXWGHD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclohepta-1,3,5-trien-1-yl-3-methoxypropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohepta-1,3,5-trien-1-yl-3-methoxypropan-1-one?
The IUPAC name of 1-cyclohepta-1,3,5-trien-1-yl-3-methoxypropan-1-one (CID 15353171) is 1-cyclohepta-1,3,5-trien-1-yl-3-methoxypropan-1-one.
What is the SMILES notation for 1-cyclohepta-1,3,5-trien-1-yl-3-methoxypropan-1-one?
The canonical SMILES for 1-cyclohepta-1,3,5-trien-1-yl-3-methoxypropan-1-one is COCCC(=O)C1=CC=CC=CC1.
What is the InChIKey of 1-cyclohepta-1,3,5-trien-1-yl-3-methoxypropan-1-one?
The InChIKey is JAQHNCUYRXWGHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c1-13-9-8-11(12)10-6-4-2-3-5-7-10/h2-6H,7-9H2,1H3.
What are the key properties of 1-cyclohepta-1,3,5-trien-1-yl-3-methoxypropan-1-one?
1-cyclohepta-1,3,5-trien-1-yl-3-methoxypropan-1-one has a molecular weight of 178.23 g/mol, XLogP of 2.03, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohepta-1,3,5-trien-1-yl-3-methoxypropan-1-one is sourced from PubChem (CID 15353171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).