About 2-anilinothieno[3,2-c]pyridine-3-carbonitrile
2-anilinothieno[3,2-c]pyridine-3-carbonitrile (PubChem CID 15353724) has the molecular formula C14H9N3S
and a molecular weight of 251.31 g/mol. Its IUPAC name is 2-anilinothieno[3,2-c]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-anilinothieno[3,2-c]pyridine-3-carbonitrile |
| PubChem CID | 15353724 |
| Molecular Formula | C14H9N3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 2-anilinothieno[3,2-c]pyridine-3-carbonitrile |
| SMILES | N#Cc1c(Nc2ccccc2)sc2ccncc12 |
| InChI | InChI=1S/C14H9N3S/c15-8-11-12-9-16-7-6-13(12)18-14(11)17-10-4-2-1-3-5-10/h1-7,9,17H |
| InChIKey | XQMOKTQSYKVRFB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-anilinothieno[3,2-c]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilinothieno[3,2-c]pyridine-3-carbonitrile?
The IUPAC name of 2-anilinothieno[3,2-c]pyridine-3-carbonitrile (CID 15353724) is 2-anilinothieno[3,2-c]pyridine-3-carbonitrile.
What is the SMILES notation for 2-anilinothieno[3,2-c]pyridine-3-carbonitrile?
The canonical SMILES for 2-anilinothieno[3,2-c]pyridine-3-carbonitrile is N#Cc1c(Nc2ccccc2)sc2ccncc12.
What is the InChIKey of 2-anilinothieno[3,2-c]pyridine-3-carbonitrile?
The InChIKey is XQMOKTQSYKVRFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N3S/c15-8-11-12-9-16-7-6-13(12)18-14(11)17-10-4-2-1-3-5-10/h1-7,9,17H.
What are the key properties of 2-anilinothieno[3,2-c]pyridine-3-carbonitrile?
2-anilinothieno[3,2-c]pyridine-3-carbonitrile has a molecular weight of 251.31 g/mol, XLogP of 3.91, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilinothieno[3,2-c]pyridine-3-carbonitrile is sourced from PubChem (CID 15353724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).