About 2-bromo-3-butylthiophene
2-bromo-3-butylthiophene (PubChem CID 15354891) has the molecular formula C8H11BrS
and a molecular weight of 219.15 g/mol. Its IUPAC name is 2-bromo-3-butylthiophene.
Molecular Properties
| Compound Name | 2-bromo-3-butylthiophene |
| PubChem CID | 15354891 |
| Molecular Formula | C8H11BrS |
| Molecular Weight | 219.15 g/mol |
| Exact Mass | 217.98 |
| IUPAC Name | 2-bromo-3-butylthiophene |
| SMILES | CCCCc1ccsc1Br |
| InChI | InChI=1S/C8H11BrS/c1-2-3-4-7-5-6-10-8(7)9/h5-6H,2-4H2,1H3 |
| InChIKey | KNBLITSBUDZSJW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.15 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-3-butylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3-butylthiophene?
The IUPAC name of 2-bromo-3-butylthiophene (CID 15354891) is 2-bromo-3-butylthiophene.
What is the SMILES notation for 2-bromo-3-butylthiophene?
The canonical SMILES for 2-bromo-3-butylthiophene is CCCCc1ccsc1Br.
What is the InChIKey of 2-bromo-3-butylthiophene?
The InChIKey is KNBLITSBUDZSJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BrS/c1-2-3-4-7-5-6-10-8(7)9/h5-6H,2-4H2,1H3.
What are the key properties of 2-bromo-3-butylthiophene?
2-bromo-3-butylthiophene has a molecular weight of 219.15 g/mol, XLogP of 3.85, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3-butylthiophene is sourced from PubChem (CID 15354891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).