About 8-methyl-1H-benzo[b][1,8]naphthyridin-2-one
8-methyl-1H-benzo[b][1,8]naphthyridin-2-one (PubChem CID 15355237) has the molecular formula C13H10N2O
and a molecular weight of 210.24 g/mol. Its IUPAC name is 8-methyl-1H-benzo[b][1,8]naphthyridin-2-one.
Molecular Properties
| Compound Name | 8-methyl-1H-benzo[b][1,8]naphthyridin-2-one |
| PubChem CID | 15355237 |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 8-methyl-1H-benzo[b][1,8]naphthyridin-2-one |
| SMILES | Cc1ccc2cc3ccc(=O)[nH]c3nc2c1 |
| InChI | InChI=1S/C13H10N2O/c1-8-2-3-9-7-10-4-5-12(16)15-13(10)14-11(9)6-8/h2-7H,1H3,(H,14,15,16) |
| InChIKey | TUJTYAZBPYFVAI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 8-methyl-1H-benzo[b][1,8]naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-1H-benzo[b][1,8]naphthyridin-2-one?
The IUPAC name of 8-methyl-1H-benzo[b][1,8]naphthyridin-2-one (CID 15355237) is 8-methyl-1H-benzo[b][1,8]naphthyridin-2-one.
What is the SMILES notation for 8-methyl-1H-benzo[b][1,8]naphthyridin-2-one?
The canonical SMILES for 8-methyl-1H-benzo[b][1,8]naphthyridin-2-one is Cc1ccc2cc3ccc(=O)[nH]c3nc2c1.
What is the InChIKey of 8-methyl-1H-benzo[b][1,8]naphthyridin-2-one?
The InChIKey is TUJTYAZBPYFVAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O/c1-8-2-3-9-7-10-4-5-12(16)15-13(10)14-11(9)6-8/h2-7H,1H3,(H,14,15,16).
What are the key properties of 8-methyl-1H-benzo[b][1,8]naphthyridin-2-one?
8-methyl-1H-benzo[b][1,8]naphthyridin-2-one has a molecular weight of 210.24 g/mol, XLogP of 2.38, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-1H-benzo[b][1,8]naphthyridin-2-one is sourced from PubChem (CID 15355237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).