2-ethenylpent-4-enoic acid

C7H10O2 — CID 15355370

IUPAC2-ethenylpent-4-enoic acid
SMILESC=CCC(C=C)C(=O)O
InChIInChI=1S/C7H10O2/c1-3-5-6(4-2)7(8)9/h3-4,6H,1-2,5H2,(H,8,9)
InChIKeyOZUCHURUUWTBKY-UHFFFAOYSA-N
MW126.15 g/mol
LogP1.45
Rot. Bonds4

About 2-ethenylpent-4-enoic acid

2-ethenylpent-4-enoic acid (PubChem CID 15355370) has the molecular formula C7H10O2 and a molecular weight of 126.15 g/mol. Its IUPAC name is 2-ethenylpent-4-enoic acid.

Molecular Properties

Compound Name2-ethenylpent-4-enoic acid
PubChem CID15355370
Molecular FormulaC7H10O2
Molecular Weight126.15 g/mol
Exact Mass126.07
IUPAC Name2-ethenylpent-4-enoic acid
SMILESC=CCC(C=C)C(=O)O
InChIInChI=1S/C7H10O2/c1-3-5-6(4-2)7(8)9/h3-4,6H,1-2,5H2,(H,8,9)
InChIKeyOZUCHURUUWTBKY-UHFFFAOYSA-N
XLogP1.45
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500126.15
LogP ≤ 51.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-ethenylpent-4-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethenylpent-4-enoic acid?
The IUPAC name of 2-ethenylpent-4-enoic acid (CID 15355370) is 2-ethenylpent-4-enoic acid.
What is the SMILES notation for 2-ethenylpent-4-enoic acid?
The canonical SMILES for 2-ethenylpent-4-enoic acid is C=CCC(C=C)C(=O)O.
What is the InChIKey of 2-ethenylpent-4-enoic acid?
The InChIKey is OZUCHURUUWTBKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2/c1-3-5-6(4-2)7(8)9/h3-4,6H,1-2,5H2,(H,8,9).
What are the key properties of 2-ethenylpent-4-enoic acid?
2-ethenylpent-4-enoic acid has a molecular weight of 126.15 g/mol, XLogP of 1.45, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylpent-4-enoic acid is sourced from PubChem (CID 15355370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).