2-ethenylhexanoic acid

C8H14O2 — CID 15355371

IUPAC2-ethenylhexanoic acid
SMILESC=CC(CCCC)C(=O)O
InChIInChI=1S/C8H14O2/c1-3-5-6-7(4-2)8(9)10/h4,7H,2-3,5-6H2,1H3,(H,9,10)
InChIKeyPYCAYRVYUMKDTD-UHFFFAOYSA-N
MW142.20 g/mol
LogP2.06
Rot. Bonds5

About 2-ethenylhexanoic acid

2-ethenylhexanoic acid (PubChem CID 15355371) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is 2-ethenylhexanoic acid.

Molecular Properties

Compound Name2-ethenylhexanoic acid
PubChem CID15355371
Molecular FormulaC8H14O2
Molecular Weight142.20 g/mol
Exact Mass142.10
IUPAC Name2-ethenylhexanoic acid
SMILESC=CC(CCCC)C(=O)O
InChIInChI=1S/C8H14O2/c1-3-5-6-7(4-2)8(9)10/h4,7H,2-3,5-6H2,1H3,(H,9,10)
InChIKeyPYCAYRVYUMKDTD-UHFFFAOYSA-N
XLogP2.06
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500142.20
LogP ≤ 52.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-ethenylhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethenylhexanoic acid?
The IUPAC name of 2-ethenylhexanoic acid (CID 15355371) is 2-ethenylhexanoic acid.
What is the SMILES notation for 2-ethenylhexanoic acid?
The canonical SMILES for 2-ethenylhexanoic acid is C=CC(CCCC)C(=O)O.
What is the InChIKey of 2-ethenylhexanoic acid?
The InChIKey is PYCAYRVYUMKDTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-3-5-6-7(4-2)8(9)10/h4,7H,2-3,5-6H2,1H3,(H,9,10).
What are the key properties of 2-ethenylhexanoic acid?
2-ethenylhexanoic acid has a molecular weight of 142.20 g/mol, XLogP of 2.06, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylhexanoic acid is sourced from PubChem (CID 15355371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).