C11H16O5 — CID 15355817
5-(1-methoxyprop-2-enyl)-2,2,5-trimethyl-1,3-dioxane-4,6-dione (PubChem CID 15355817) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is 5-(1-methoxyprop-2-enyl)-2,2,5-trimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-(1-methoxyprop-2-enyl)-2,2,5-trimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 15355817 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 5-(1-methoxyprop-2-enyl)-2,2,5-trimethyl-1,3-dioxane-4,6-dione |
| SMILES | C=CC(OC)C1(C)C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C11H16O5/c1-6-7(14-5)11(4)8(12)15-10(2,3)16-9(11)13/h6-7H,1H2,2-5H3 |
| InChIKey | YCXFYHVVJFTNTO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|