C8H9I2NS — CID 15356411
3-(iodomethyl)-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridin-4-ium iodide (PubChem CID 15356411) has the molecular formula C8H9I2NS and a molecular weight of 405.04 g/mol. Its IUPAC name is 3-(iodomethyl)-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridin-4-ium iodide.
| Compound Name | 3-(iodomethyl)-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridin-4-ium iodide |
|---|---|
| PubChem CID | 15356411 |
| Molecular Formula | C8H9I2NS |
| Molecular Weight | 405.04 g/mol |
| Exact Mass | 404.85 |
| IUPAC Name | 3-(iodomethyl)-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridin-4-ium iodide |
| SMILES | ICC1CSc2cccc[n+]21.[I-] |
| InChI | InChI=1S/C8H9INS.HI/c9-5-7-6-11-8-3-1-2-4-10(7)8;/h1-4,7H,5-6H2;1H/q+1;/p-1 |
| InChIKey | MBLNCLMNYUKZKY-UHFFFAOYSA-M |
| XLogP | -0.94 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.04 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|