5-pyrazol-1-ylpentanoic acid

C8H12N2O2 — CID 15356622

IUPAC5-pyrazol-1-ylpentanoic acid
SMILESO=C(O)CCCCn1cccn1
InChIInChI=1S/C8H12N2O2/c11-8(12)4-1-2-6-10-7-3-5-9-10/h3,5,7H,1-2,4,6H2,(H,11,12)
InChIKeyYMFQLAHROLJYTE-UHFFFAOYSA-N
MW168.20 g/mol
LogP1.14
Rot. Bonds5

About 5-pyrazol-1-ylpentanoic acid

5-pyrazol-1-ylpentanoic acid (PubChem CID 15356622) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 5-pyrazol-1-ylpentanoic acid.

Molecular Properties

Compound Name5-pyrazol-1-ylpentanoic acid
PubChem CID15356622
Molecular FormulaC8H12N2O2
Molecular Weight168.20 g/mol
Exact Mass168.09
IUPAC Name5-pyrazol-1-ylpentanoic acid
SMILESO=C(O)CCCCn1cccn1
InChIInChI=1S/C8H12N2O2/c11-8(12)4-1-2-6-10-7-3-5-9-10/h3,5,7H,1-2,4,6H2,(H,11,12)
InChIKeyYMFQLAHROLJYTE-UHFFFAOYSA-N
XLogP1.14
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.20
LogP ≤ 51.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-pyrazol-1-ylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-pyrazol-1-ylpentanoic acid?
The IUPAC name of 5-pyrazol-1-ylpentanoic acid (CID 15356622) is 5-pyrazol-1-ylpentanoic acid.
What is the SMILES notation for 5-pyrazol-1-ylpentanoic acid?
The canonical SMILES for 5-pyrazol-1-ylpentanoic acid is O=C(O)CCCCn1cccn1.
What is the InChIKey of 5-pyrazol-1-ylpentanoic acid?
The InChIKey is YMFQLAHROLJYTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c11-8(12)4-1-2-6-10-7-3-5-9-10/h3,5,7H,1-2,4,6H2,(H,11,12).
What are the key properties of 5-pyrazol-1-ylpentanoic acid?
5-pyrazol-1-ylpentanoic acid has a molecular weight of 168.20 g/mol, XLogP of 1.14, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyrazol-1-ylpentanoic acid is sourced from PubChem (CID 15356622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).