About 3-hydroxybutyl nitrate
3-hydroxybutyl nitrate (PubChem CID 15356836) has the molecular formula C4H9NO4
and a molecular weight of 135.12 g/mol. Its IUPAC name is 3-hydroxybutyl nitrate.
Molecular Properties
| Compound Name | 3-hydroxybutyl nitrate |
| PubChem CID | 15356836 |
| Molecular Formula | C4H9NO4 |
| Molecular Weight | 135.12 g/mol |
| Exact Mass | 135.05 |
| IUPAC Name | 3-hydroxybutyl nitrate |
| SMILES | CC(O)CCO[N+](=O)[O-] |
| InChI | InChI=1S/C4H9NO4/c1-4(6)2-3-9-5(7)8/h4,6H,2-3H2,1H3 |
| InChIKey | WUKDMTQXKGFHBU-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.12 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxybutyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxybutyl nitrate?
The IUPAC name of 3-hydroxybutyl nitrate (CID 15356836) is 3-hydroxybutyl nitrate.
What is the SMILES notation for 3-hydroxybutyl nitrate?
The canonical SMILES for 3-hydroxybutyl nitrate is CC(O)CCO[N+](=O)[O-].
What is the InChIKey of 3-hydroxybutyl nitrate?
The InChIKey is WUKDMTQXKGFHBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO4/c1-4(6)2-3-9-5(7)8/h4,6H,2-3H2,1H3.
What are the key properties of 3-hydroxybutyl nitrate?
3-hydroxybutyl nitrate has a molecular weight of 135.12 g/mol, XLogP of -0.03, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxybutyl nitrate is sourced from PubChem (CID 15356836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).