About 5-chloro-2-methoxy-1,3-dimethylbenzene
5-chloro-2-methoxy-1,3-dimethylbenzene (PubChem CID 15357078) has the molecular formula C9H11ClO
and a molecular weight of 170.64 g/mol. Its IUPAC name is 5-chloro-2-methoxy-1,3-dimethylbenzene.
Molecular Properties
| Compound Name | 5-chloro-2-methoxy-1,3-dimethylbenzene |
| PubChem CID | 15357078 |
| Molecular Formula | C9H11ClO |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 5-chloro-2-methoxy-1,3-dimethylbenzene |
| SMILES | COc1c(C)cc(Cl)cc1C |
| InChI | InChI=1S/C9H11ClO/c1-6-4-8(10)5-7(2)9(6)11-3/h4-5H,1-3H3 |
| InChIKey | MXAOCQCPDIIBGZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-chloro-2-methoxy-1,3-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-methoxy-1,3-dimethylbenzene?
The IUPAC name of 5-chloro-2-methoxy-1,3-dimethylbenzene (CID 15357078) is 5-chloro-2-methoxy-1,3-dimethylbenzene.
What is the SMILES notation for 5-chloro-2-methoxy-1,3-dimethylbenzene?
The canonical SMILES for 5-chloro-2-methoxy-1,3-dimethylbenzene is COc1c(C)cc(Cl)cc1C.
What is the InChIKey of 5-chloro-2-methoxy-1,3-dimethylbenzene?
The InChIKey is MXAOCQCPDIIBGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClO/c1-6-4-8(10)5-7(2)9(6)11-3/h4-5H,1-3H3.
What are the key properties of 5-chloro-2-methoxy-1,3-dimethylbenzene?
5-chloro-2-methoxy-1,3-dimethylbenzene has a molecular weight of 170.64 g/mol, XLogP of 2.97, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-methoxy-1,3-dimethylbenzene is sourced from PubChem (CID 15357078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).