C15H28N2O4 — CID 15357287
ditert-butyl (4S,5S)-4,5-dimethylimidazolidine-1,3-dicarboxylate (PubChem CID 15357287) has the molecular formula C15H28N2O4 and a molecular weight of 300.40 g/mol. Its IUPAC name is ditert-butyl (4S,5S)-4,5-dimethylimidazolidine-1,3-dicarboxylate.
| Compound Name | ditert-butyl (4S,5S)-4,5-dimethylimidazolidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 15357287 |
| Molecular Formula | C15H28N2O4 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | ditert-butyl (4S,5S)-4,5-dimethylimidazolidine-1,3-dicarboxylate |
| SMILES | C[C@H]1[C@H](C)N(C(=O)OC(C)(C)C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H28N2O4/c1-10-11(2)17(13(19)21-15(6,7)8)9-16(10)12(18)20-14(3,4)5/h10-11H,9H2,1-8H3/t10-,11-/m0/s1 |
| InChIKey | NOKLOCTUHNQBMI-QWRGUYRKSA-N |
| XLogP | 3.21 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |