C14H8N4 — CID 15357442
5-[(E)-2-phenylethenyl]pyrazine-2,3-dicarbonitrile (PubChem CID 15357442) has the molecular formula C14H8N4 and a molecular weight of 232.25 g/mol. Its IUPAC name is 5-[(E)-2-phenylethenyl]pyrazine-2,3-dicarbonitrile.
| Compound Name | 5-[(E)-2-phenylethenyl]pyrazine-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 15357442 |
| Molecular Formula | C14H8N4 |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 5-[(E)-2-phenylethenyl]pyrazine-2,3-dicarbonitrile |
| SMILES | N#Cc1ncc(/C=C/c2ccccc2)nc1C#N |
| InChI | InChI=1S/C14H8N4/c15-8-13-14(9-16)18-12(10-17-13)7-6-11-4-2-1-3-5-11/h1-7,10H/b7-6+ |
| InChIKey | PDGKUTCZIPVJCG-VOTSOKGWSA-N |
| XLogP | 2.39 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |