About 2-fluoro-N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide
2-fluoro-N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide (PubChem CID 15357553) has the molecular formula C12H16FNO2
and a molecular weight of 225.26 g/mol. Its IUPAC name is 2-fluoro-N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide.
Molecular Properties
| Compound Name | 2-fluoro-N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide |
| PubChem CID | 15357553 |
| Molecular Formula | C12H16FNO2 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-fluoro-N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide |
| SMILES | C[C@H]([C@H](O)c1ccccc1)N(C)C(=O)CF |
| InChI | InChI=1S/C12H16FNO2/c1-9(14(2)11(15)8-13)12(16)10-6-4-3-5-7-10/h3-7,9,12,16H,8H2,1-2H3/t9-,12+/m1/s1 |
| InChIKey | KSTGIVVNSIGUMP-SKDRFNHKSA-N |
| XLogP | 1.54 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-fluoro-N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide?
The IUPAC name of 2-fluoro-N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide (CID 15357553) is 2-fluoro-N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide.
What is the SMILES notation for 2-fluoro-N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide?
The canonical SMILES for 2-fluoro-N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide is C[C@H]([C@H](O)c1ccccc1)N(C)C(=O)CF.
What is the InChIKey of 2-fluoro-N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide?
The InChIKey is KSTGIVVNSIGUMP-SKDRFNHKSA-N. The full InChI is InChI=1S/C12H16FNO2/c1-9(14(2)11(15)8-13)12(16)10-6-4-3-5-7-10/h3-7,9,12,16H,8H2,1-2H3/t9-,12+/m1/s1.
What are the key properties of 2-fluoro-N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide?
2-fluoro-N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide has a molecular weight of 225.26 g/mol, XLogP of 1.54, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide is sourced from PubChem (CID 15357553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).