About N,6-dimethylimidazo[2,1-b][1,3,4]thiadiazol-2-amine
N,6-dimethylimidazo[2,1-b][1,3,4]thiadiazol-2-amine (PubChem CID 15357579) has the molecular formula C6H8N4S
and a molecular weight of 168.22 g/mol. Its IUPAC name is N,6-dimethylimidazo[2,1-b][1,3,4]thiadiazol-2-amine.
Analyze N,6-dimethylimidazo[2,1-b][1,3,4]thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,6-dimethylimidazo[2,1-b][1,3,4]thiadiazol-2-amine?
The IUPAC name of N,6-dimethylimidazo[2,1-b][1,3,4]thiadiazol-2-amine (CID 15357579) is N,6-dimethylimidazo[2,1-b][1,3,4]thiadiazol-2-amine.
What is the SMILES notation for N,6-dimethylimidazo[2,1-b][1,3,4]thiadiazol-2-amine?
The canonical SMILES for N,6-dimethylimidazo[2,1-b][1,3,4]thiadiazol-2-amine is CNc1nn2cc(C)nc2s1.
What is the InChIKey of N,6-dimethylimidazo[2,1-b][1,3,4]thiadiazol-2-amine?
The InChIKey is CPUDCQFQYWLGFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4S/c1-4-3-10-6(8-4)11-5(7-2)9-10/h3H,1-2H3,(H,7,9).
What are the key properties of N,6-dimethylimidazo[2,1-b][1,3,4]thiadiazol-2-amine?
N,6-dimethylimidazo[2,1-b][1,3,4]thiadiazol-2-amine has a molecular weight of 168.22 g/mol, XLogP of 1.14, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,6-dimethylimidazo[2,1-b][1,3,4]thiadiazol-2-amine is sourced from PubChem (CID 15357579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).