C12H17Br — CID 15357969
(4E)-2-bromo-4-ethyldeca-1,4-dien-8-yne (PubChem CID 15357969) has the molecular formula C12H17Br and a molecular weight of 241.17 g/mol. Its IUPAC name is (4E)-2-bromo-4-ethyldeca-1,4-dien-8-yne.
| Compound Name | (4E)-2-bromo-4-ethyldeca-1,4-dien-8-yne |
|---|---|
| PubChem CID | 15357969 |
| Molecular Formula | C12H17Br |
| Molecular Weight | 241.17 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | (4E)-2-bromo-4-ethyldeca-1,4-dien-8-yne |
| SMILES | C=C(Br)C/C(=C/CCC#CC)CC |
| InChI | InChI=1S/C12H17Br/c1-4-6-7-8-9-12(5-2)10-11(3)13/h9H,3,5,7-8,10H2,1-2H3/b12-9+ |
| InChIKey | BRENCTXWKWLHDT-FMIVXFBMSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.17 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|