C8H15BrO4 — CID 15358327
(4S,5S)-2-(bromomethyl)-4,5-bis(methoxymethyl)-1,3-dioxolane (PubChem CID 15358327) has the molecular formula C8H15BrO4 and a molecular weight of 255.11 g/mol. Its IUPAC name is (4S,5S)-2-(bromomethyl)-4,5-bis(methoxymethyl)-1,3-dioxolane.
| Compound Name | (4S,5S)-2-(bromomethyl)-4,5-bis(methoxymethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 15358327 |
| Molecular Formula | C8H15BrO4 |
| Molecular Weight | 255.11 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | (4S,5S)-2-(bromomethyl)-4,5-bis(methoxymethyl)-1,3-dioxolane |
| SMILES | COC[C@@H]1OC(CBr)O[C@H]1COC |
| InChI | InChI=1S/C8H15BrO4/c1-10-4-6-7(5-11-2)13-8(3-9)12-6/h6-8H,3-5H2,1-2H3/t6-,7-/m0/s1 |
| InChIKey | SUPVKDYNFYJGPT-BQBZGAKWSA-N |
| XLogP | 0.78 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.11 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|