About methyl-[(1R,2S)-2-methylcyclohexyl]oxy-diphenylsilane
methyl-[(1R,2S)-2-methylcyclohexyl]oxy-diphenylsilane (PubChem CID 15358388) has the molecular formula C20H26OSi
and a molecular weight of 310.51 g/mol. Its IUPAC name is methyl-[(1R,2S)-2-methylcyclohexyl]oxy-diphenylsilane.
Molecular Properties
| Compound Name | methyl-[(1R,2S)-2-methylcyclohexyl]oxy-diphenylsilane |
| PubChem CID | 15358388 |
| Molecular Formula | C20H26OSi |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | methyl-[(1R,2S)-2-methylcyclohexyl]oxy-diphenylsilane |
| SMILES | C[C@H]1CCCC[C@H]1O[Si](C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H26OSi/c1-17-11-9-10-16-20(17)21-22(2,18-12-5-3-6-13-18)19-14-7-4-8-15-19/h3-8,12-15,17,20H,9-11,16H2,1-2H3/t17-,20+/m0/s1 |
| InChIKey | ASHFVEBMVOKLCJ-FXAWDEMLSA-N |
| XLogP | 3.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl-[(1R,2S)-2-methylcyclohexyl]oxy-diphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-[(1R,2S)-2-methylcyclohexyl]oxy-diphenylsilane?
The IUPAC name of methyl-[(1R,2S)-2-methylcyclohexyl]oxy-diphenylsilane (CID 15358388) is methyl-[(1R,2S)-2-methylcyclohexyl]oxy-diphenylsilane.
What is the SMILES notation for methyl-[(1R,2S)-2-methylcyclohexyl]oxy-diphenylsilane?
The canonical SMILES for methyl-[(1R,2S)-2-methylcyclohexyl]oxy-diphenylsilane is C[C@H]1CCCC[C@H]1O[Si](C)(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl-[(1R,2S)-2-methylcyclohexyl]oxy-diphenylsilane?
The InChIKey is ASHFVEBMVOKLCJ-FXAWDEMLSA-N. The full InChI is InChI=1S/C20H26OSi/c1-17-11-9-10-16-20(17)21-22(2,18-12-5-3-6-13-18)19-14-7-4-8-15-19/h3-8,12-15,17,20H,9-11,16H2,1-2H3/t17-,20+/m0/s1.
What are the key properties of methyl-[(1R,2S)-2-methylcyclohexyl]oxy-diphenylsilane?
methyl-[(1R,2S)-2-methylcyclohexyl]oxy-diphenylsilane has a molecular weight of 310.51 g/mol, XLogP of 3.97, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-[(1R,2S)-2-methylcyclohexyl]oxy-diphenylsilane is sourced from PubChem (CID 15358388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).