C21H19N3O2S — CID 15358623
3-(furan-2-ylmethyl)-2-(1,2,3,4-tetrahydroacridin-9-ylimino)-1,3-thiazolidin-4-one (PubChem CID 15358623) has the molecular formula C21H19N3O2S and a molecular weight of 377.47 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-2-(1,2,3,4-tetrahydroacridin-9-ylimino)-1,3-thiazolidin-4-one.
| Compound Name | 3-(furan-2-ylmethyl)-2-(1,2,3,4-tetrahydroacridin-9-ylimino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 15358623 |
| Molecular Formula | C21H19N3O2S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 3-(furan-2-ylmethyl)-2-(1,2,3,4-tetrahydroacridin-9-ylimino)-1,3-thiazolidin-4-one |
| SMILES | O=C1CS/C(=N\c2c3c(nc4ccccc24)CCCC3)N1Cc1ccco1 |
| InChI | InChI=1S/C21H19N3O2S/c25-19-13-27-21(24(19)12-14-6-5-11-26-14)23-20-15-7-1-3-9-17(15)22-18-10-4-2-8-16(18)20/h1,3,5-7,9,11H,2,4,8,10,12-13H2/b23-21- |
| InChIKey | PPAJFBGWVJHTRM-LNVKXUELSA-N |
| XLogP | 4.47 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|