C21H30O3Si — CID 15359306
methyl (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-phenylcyclohepta-1,5-diene-1-carboxylate (PubChem CID 15359306) has the molecular formula C21H30O3Si and a molecular weight of 358.55 g/mol. Its IUPAC name is methyl (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-phenylcyclohepta-1,5-diene-1-carboxylate.
| Compound Name | methyl (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-phenylcyclohepta-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 15359306 |
| Molecular Formula | C21H30O3Si |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | methyl (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-phenylcyclohepta-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=C[C@@H](c2ccccc2)[C@@H](O[Si](C)(C)C(C)(C)C)C=CC1 |
| InChI | InChI=1S/C21H30O3Si/c1-21(2,3)25(5,6)24-19-14-10-13-17(20(22)23-4)15-18(19)16-11-8-7-9-12-16/h7-12,14-15,18-19H,13H2,1-6H3/t18-,19-/m0/s1 |
| InChIKey | QEILTOMNYGGLGJ-OALUTQOASA-N |
| XLogP | 5.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|