C9H11N3O3S — CID 15359587
4-methyl-1-oxido-2-propyl-[1,3]thiazolo[5,4-d]pyrimidin-1-ium-5,7-dione (PubChem CID 15359587) has the molecular formula C9H11N3O3S and a molecular weight of 241.27 g/mol. Its IUPAC name is 4-methyl-1-oxido-2-propyl-[1,3]thiazolo[5,4-d]pyrimidin-1-ium-5,7-dione.
| Compound Name | 4-methyl-1-oxido-2-propyl-[1,3]thiazolo[5,4-d]pyrimidin-1-ium-5,7-dione |
|---|---|
| PubChem CID | 15359587 |
| Molecular Formula | C9H11N3O3S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 4-methyl-1-oxido-2-propyl-[1,3]thiazolo[5,4-d]pyrimidin-1-ium-5,7-dione |
| SMILES | CCCc1sc2c(c(=O)[nH]c(=O)n2C)[n+]1[O-] |
| InChI | InChI=1S/C9H11N3O3S/c1-3-4-5-12(15)6-7(13)10-9(14)11(2)8(6)16-5/h3-4H2,1-2H3,(H,10,13,14) |
| InChIKey | YHGNIXJBEWMUKN-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 81.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|