About CID 15359798
CID 15359798 (PubChem CID 15359798) has the molecular formula C22H23Br2N2O7P
and a molecular weight of 618.22 g/mol.
Molecular Properties
| Compound Name | CID 15359798 |
| PubChem CID | 15359798 |
| Molecular Formula | C22H23Br2N2O7P |
| Molecular Weight | 618.22 g/mol |
| Exact Mass | 615.96 |
| IUPAC Name | — |
| SMILES | CCOP1(OCC)(OCC)OC2(C(=O)Nc3ccc(Br)cc32)C2(O1)C(=O)Nc1ccc(Br)cc12 |
| InChI | InChI=1S/C22H23Br2N2O7P/c1-4-29-34(30-5-2,31-6-3)32-21(15-11-13(23)7-9-17(15)25-19(21)27)22(33-34)16-12-14(24)8-10-18(16)26-20(22)28/h7-12H,4-6H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | XXHGHXOJZFHXER-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 618.22 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 15359798 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 15359798?
The IUPAC name of CID 15359798 (CID 15359798) is not available.
What is the SMILES notation for CID 15359798?
The canonical SMILES for CID 15359798 is CCOP1(OCC)(OCC)OC2(C(=O)Nc3ccc(Br)cc32)C2(O1)C(=O)Nc1ccc(Br)cc12.
What is the InChIKey of CID 15359798?
The InChIKey is XXHGHXOJZFHXER-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23Br2N2O7P/c1-4-29-34(30-5-2,31-6-3)32-21(15-11-13(23)7-9-17(15)25-19(21)27)22(33-34)16-12-14(24)8-10-18(16)26-20(22)28/h7-12H,4-6H2,1-3H3,(H,25,27)(H,26,28).
What are the key properties of CID 15359798?
CID 15359798 has a molecular weight of 618.22 g/mol, XLogP of 5.49, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 15359798 is sourced from PubChem (CID 15359798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).