C19H27F3O4S2 — CID 15359800
[(4aR,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-3-yl] trifluoromethanesulfonate (PubChem CID 15359800) has the molecular formula C19H27F3O4S2 and a molecular weight of 440.55 g/mol. Its IUPAC name is [(4aR,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-3-yl] trifluoromethanesulfonate.
| Compound Name | [(4aR,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 15359800 |
| Molecular Formula | C19H27F3O4S2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | [(4aR,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-3-yl] trifluoromethanesulfonate |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)OCS(Cc1ccccc1)(OS(=O)(=O)C(F)(F)F)C2(C)C |
| InChI | InChI=1S/C19H27F3O4S2/c1-14-9-10-16-17(11-14)25-13-27(18(16,2)3,12-15-7-5-4-6-8-15)26-28(23,24)19(20,21)22/h4-8,14,16-17H,9-13H2,1-3H3/t14-,16-,17-/m1/s1 |
| InChIKey | HZDSKOYVMMDYDG-DJIMGWMZSA-N |
| XLogP | 5.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|