About 4H-3,1-benzothiazine-2-carbonitrile
4H-3,1-benzothiazine-2-carbonitrile (PubChem CID 15360066) has the molecular formula C9H6N2S
and a molecular weight of 174.23 g/mol. Its IUPAC name is 4H-3,1-benzothiazine-2-carbonitrile.
Molecular Properties
| Compound Name | 4H-3,1-benzothiazine-2-carbonitrile |
| PubChem CID | 15360066 |
| Molecular Formula | C9H6N2S |
| Molecular Weight | 174.23 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | 4H-3,1-benzothiazine-2-carbonitrile |
| SMILES | N#CC1=Nc2ccccc2CS1 |
| InChI | InChI=1S/C9H6N2S/c10-5-9-11-8-4-2-1-3-7(8)6-12-9/h1-4H,6H2 |
| InChIKey | MIGRQVZPANFZJC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.23 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4H-3,1-benzothiazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-3,1-benzothiazine-2-carbonitrile?
The IUPAC name of 4H-3,1-benzothiazine-2-carbonitrile (CID 15360066) is 4H-3,1-benzothiazine-2-carbonitrile.
What is the SMILES notation for 4H-3,1-benzothiazine-2-carbonitrile?
The canonical SMILES for 4H-3,1-benzothiazine-2-carbonitrile is N#CC1=Nc2ccccc2CS1.
What is the InChIKey of 4H-3,1-benzothiazine-2-carbonitrile?
The InChIKey is MIGRQVZPANFZJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2S/c10-5-9-11-8-4-2-1-3-7(8)6-12-9/h1-4H,6H2.
What are the key properties of 4H-3,1-benzothiazine-2-carbonitrile?
4H-3,1-benzothiazine-2-carbonitrile has a molecular weight of 174.23 g/mol, XLogP of 2.49, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-3,1-benzothiazine-2-carbonitrile is sourced from PubChem (CID 15360066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).