C22H14N2 — CID 15360951
1,12-dimethylbenzo[c]phenanthrene-5,8-dicarbonitrile (PubChem CID 15360951) has the molecular formula C22H14N2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 1,12-dimethylbenzo[c]phenanthrene-5,8-dicarbonitrile.
| Compound Name | 1,12-dimethylbenzo[c]phenanthrene-5,8-dicarbonitrile |
|---|---|
| PubChem CID | 15360951 |
| Molecular Formula | C22H14N2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1,12-dimethylbenzo[c]phenanthrene-5,8-dicarbonitrile |
| SMILES | Cc1cccc2c(C#N)cc3cc(C#N)c4cccc(C)c4c3c12 |
| InChI | InChI=1S/C22H14N2/c1-13-5-3-7-18-16(11-23)9-15-10-17(12-24)19-8-4-6-14(2)21(19)22(15)20(13)18/h3-10H,1-2H3 |
| InChIKey | FYGKAZRLMNPXKG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|