About 1,12-dimethylbenzo[c]phenanthrene-5,8-dicarbonitrile
1,12-dimethylbenzo[c]phenanthrene-5,8-dicarbonitrile (PubChem CID 15360951) has the molecular formula C22H14N2
and a molecular weight of 306.37 g/mol. Its IUPAC name is 1,12-dimethylbenzo[c]phenanthrene-5,8-dicarbonitrile.
Molecular Properties
| Compound Name | 1,12-dimethylbenzo[c]phenanthrene-5,8-dicarbonitrile |
| PubChem CID | 15360951 |
| Molecular Formula | C22H14N2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1,12-dimethylbenzo[c]phenanthrene-5,8-dicarbonitrile |
| SMILES | Cc1cccc2c(C#N)cc3cc(C#N)c4cccc(C)c4c3c12 |
| InChI | InChI=1S/C22H14N2/c1-13-5-3-7-18-16(11-23)9-15-10-17(12-24)19-8-4-6-14(2)21(19)22(15)20(13)18/h3-10H,1-2H3 |
| InChIKey | FYGKAZRLMNPXKG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1,12-dimethylbenzo[c]phenanthrene-5,8-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,12-dimethylbenzo[c]phenanthrene-5,8-dicarbonitrile?
The IUPAC name of 1,12-dimethylbenzo[c]phenanthrene-5,8-dicarbonitrile (CID 15360951) is 1,12-dimethylbenzo[c]phenanthrene-5,8-dicarbonitrile.
What is the SMILES notation for 1,12-dimethylbenzo[c]phenanthrene-5,8-dicarbonitrile?
The canonical SMILES for 1,12-dimethylbenzo[c]phenanthrene-5,8-dicarbonitrile is Cc1cccc2c(C#N)cc3cc(C#N)c4cccc(C)c4c3c12.
What is the InChIKey of 1,12-dimethylbenzo[c]phenanthrene-5,8-dicarbonitrile?
The InChIKey is FYGKAZRLMNPXKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14N2/c1-13-5-3-7-18-16(11-23)9-15-10-17(12-24)19-8-4-6-14(2)21(19)22(15)20(13)18/h3-10H,1-2H3.
What are the key properties of 1,12-dimethylbenzo[c]phenanthrene-5,8-dicarbonitrile?
1,12-dimethylbenzo[c]phenanthrene-5,8-dicarbonitrile has a molecular weight of 306.37 g/mol, XLogP of 5.51, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,12-dimethylbenzo[c]phenanthrene-5,8-dicarbonitrile is sourced from PubChem (CID 15360951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).