C34H68O8Si2 — CID 15361995
(1S,2S,5S,6S)-6-(ethoxymethoxy)-1-[(5S,6R)-6-(ethoxymethoxy)-5-[hexyl(dimethyl)silyl]oxycyclohexen-1-yl]-5-[hexyl(dimethyl)silyl]oxycyclohexane-1,2-diol (PubChem CID 15361995) has the molecular formula C34H68O8Si2 and a molecular weight of 661.08 g/mol. Its IUPAC name is (1S,2S,5S,6S)-6-(ethoxymethoxy)-1-[(5S,6R)-6-(ethoxymethoxy)-5-[hexyl(dimethyl)silyl]oxycyclohexen-1-yl]-5-[hexyl(dimethyl)silyl]oxycyclohexane-1,2-diol.
| Compound Name | (1S,2S,5S,6S)-6-(ethoxymethoxy)-1-[(5S,6R)-6-(ethoxymethoxy)-5-[hexyl(dimethyl)silyl]oxycyclohexen-1-yl]-5-[hexyl(dimethyl)silyl]oxycyclohexane-1,2-diol |
|---|---|
| PubChem CID | 15361995 |
| Molecular Formula | C34H68O8Si2 |
| Molecular Weight | 661.08 g/mol |
| Exact Mass | 660.45 |
| IUPAC Name | (1S,2S,5S,6S)-6-(ethoxymethoxy)-1-[(5S,6R)-6-(ethoxymethoxy)-5-[hexyl(dimethyl)silyl]oxycyclohexen-1-yl]-5-[hexyl(dimethyl)silyl]oxycyclohexane-1,2-diol |
| SMILES | CCCCCC[Si](C)(C)OC1CC[C@H](O)[C@@](O)(C2=CCC[C@H](O[Si](C)(C)CCCCCC)[C@@H]2OCOCC)[C@H]1OCOCC |
| InChI | InChI=1S/C34H68O8Si2/c1-9-13-15-17-24-43(5,6)41-29-21-19-20-28(32(29)39-26-37-11-3)34(36)31(35)23-22-30(33(34)40-27-38-12-4)42-44(7,8)25-18-16-14-10-2/h20,29-33,35-36H,9-19,21-27H2,1-8H3/t29-,30?,31-,32+,33-,34-/m0/s1 |
| InChIKey | CRUGERMTWSBGMM-RQAUOZJPSA-N |
| XLogP | 7.69 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.08 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|