About 3-(furan-2-yl)-1,2,4,5-tetrazine
3-(furan-2-yl)-1,2,4,5-tetrazine (PubChem CID 15362134) has the molecular formula C6H4N4O
and a molecular weight of 148.12 g/mol. Its IUPAC name is 3-(furan-2-yl)-1,2,4,5-tetrazine.
Molecular Properties
| Compound Name | 3-(furan-2-yl)-1,2,4,5-tetrazine |
| PubChem CID | 15362134 |
| Molecular Formula | C6H4N4O |
| Molecular Weight | 148.12 g/mol |
| Exact Mass | 148.04 |
| IUPAC Name | 3-(furan-2-yl)-1,2,4,5-tetrazine |
| SMILES | c1coc(-c2nncnn2)c1 |
| InChI | InChI=1S/C6H4N4O/c1-2-5(11-3-1)6-9-7-4-8-10-6/h1-4H |
| InChIKey | XGSCDDFFWLGFNB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.12 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(furan-2-yl)-1,2,4,5-tetrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(furan-2-yl)-1,2,4,5-tetrazine?
The IUPAC name of 3-(furan-2-yl)-1,2,4,5-tetrazine (CID 15362134) is 3-(furan-2-yl)-1,2,4,5-tetrazine.
What is the SMILES notation for 3-(furan-2-yl)-1,2,4,5-tetrazine?
The canonical SMILES for 3-(furan-2-yl)-1,2,4,5-tetrazine is c1coc(-c2nncnn2)c1.
What is the InChIKey of 3-(furan-2-yl)-1,2,4,5-tetrazine?
The InChIKey is XGSCDDFFWLGFNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4O/c1-2-5(11-3-1)6-9-7-4-8-10-6/h1-4H.
What are the key properties of 3-(furan-2-yl)-1,2,4,5-tetrazine?
3-(furan-2-yl)-1,2,4,5-tetrazine has a molecular weight of 148.12 g/mol, XLogP of 0.53, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(furan-2-yl)-1,2,4,5-tetrazine is sourced from PubChem (CID 15362134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).