C32H25ClF3NO — CID 15363077
2-[5-chloro-2-(tritylamino)phenyl]-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol (PubChem CID 15363077) has the molecular formula C32H25ClF3NO and a molecular weight of 532.01 g/mol. Its IUPAC name is 2-[5-chloro-2-(tritylamino)phenyl]-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol.
| Compound Name | 2-[5-chloro-2-(tritylamino)phenyl]-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol |
|---|---|
| PubChem CID | 15363077 |
| Molecular Formula | C32H25ClF3NO |
| Molecular Weight | 532.01 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | 2-[5-chloro-2-(tritylamino)phenyl]-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol |
| SMILES | OC(C#CC1CC1)(c1cc(Cl)ccc1NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C32H25ClF3NO/c33-27-18-19-29(28(22-27)30(38,32(34,35)36)21-20-23-16-17-23)37-31(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-15,18-19,22-23,37-38H,16-17H2 |
| InChIKey | CKSURBJTVBMZGR-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.01 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|