C14H22O2Si — CID 15363406
3-(5-trimethylsilylpenta-3,4-dienoxy)cyclohex-2-en-1-one (PubChem CID 15363406) has the molecular formula C14H22O2Si and a molecular weight of 250.41 g/mol. Its IUPAC name is 3-(5-trimethylsilylpenta-3,4-dienoxy)cyclohex-2-en-1-one.
| Compound Name | 3-(5-trimethylsilylpenta-3,4-dienoxy)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 15363406 |
| Molecular Formula | C14H22O2Si |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 3-(5-trimethylsilylpenta-3,4-dienoxy)cyclohex-2-en-1-one |
| SMILES | C[Si](C)(C)C=C=CCCOC1=CC(=O)CCC1 |
| InChI | InChI=1S/C14H22O2Si/c1-17(2,3)11-6-4-5-10-16-14-9-7-8-13(15)12-14/h4,11-12H,5,7-10H2,1-3H3 |
| InChIKey | MMLWMOLHMWNGPQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|