C13H18O3 — CID 15363465
(3aS,6aR)-2-[(1R,2R,3S,4S)-3-methyl-2-bicyclo[2.2.1]hept-5-enyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole (PubChem CID 15363465) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (3aS,6aR)-2-[(1R,2R,3S,4S)-3-methyl-2-bicyclo[2.2.1]hept-5-enyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole.
| Compound Name | (3aS,6aR)-2-[(1R,2R,3S,4S)-3-methyl-2-bicyclo[2.2.1]hept-5-enyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 15363465 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (3aS,6aR)-2-[(1R,2R,3S,4S)-3-methyl-2-bicyclo[2.2.1]hept-5-enyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
| SMILES | C[C@@H]1[C@@H](C2O[C@H]3COC[C@H]3O2)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C13H18O3/c1-7-8-2-3-9(4-8)12(7)13-15-10-5-14-6-11(10)16-13/h2-3,7-13H,4-6H2,1H3/t7-,8+,9-,10-,11+,12+,13?/m0/s1 |
| InChIKey | UFYHTMHGSKVRNW-JDTCJQLMSA-N |
| XLogP | 1.58 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|