C22H17Cl3N6O — CID 15363628
2-N,4-N-bis(2-methylphenyl)-6-[(3,5,6-trichloro-2-pyridinyl)oxy]-1,3,5-triazine-2,4-diamine (PubChem CID 15363628) has the molecular formula C22H17Cl3N6O and a molecular weight of 487.78 g/mol. Its IUPAC name is 2-N,4-N-bis(2-methylphenyl)-6-[(3,5,6-trichloro-2-pyridinyl)oxy]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(2-methylphenyl)-6-[(3,5,6-trichloro-2-pyridinyl)oxy]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 15363628 |
| Molecular Formula | C22H17Cl3N6O |
| Molecular Weight | 487.78 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | 2-N,4-N-bis(2-methylphenyl)-6-[(3,5,6-trichloro-2-pyridinyl)oxy]-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccccc1Nc1nc(Nc2ccccc2C)nc(Oc2nc(Cl)c(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C22H17Cl3N6O/c1-12-7-3-5-9-16(12)26-20-29-21(27-17-10-6-4-8-13(17)2)31-22(30-20)32-19-15(24)11-14(23)18(25)28-19/h3-11H,1-2H3,(H2,26,27,29,30,31) |
| InChIKey | SERQJSCJXMEGHG-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 84.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.78 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|