C28H25Cl2NO6 — CID 15364094
ethyl 6-benzyl-3,3-bis(4-chlorophenyl)-7a-hydroxy-5-oxo-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate (PubChem CID 15364094) has the molecular formula C28H25Cl2NO6 and a molecular weight of 542.42 g/mol. Its IUPAC name is ethyl 6-benzyl-3,3-bis(4-chlorophenyl)-7a-hydroxy-5-oxo-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate.
| Compound Name | ethyl 6-benzyl-3,3-bis(4-chlorophenyl)-7a-hydroxy-5-oxo-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate |
|---|---|
| PubChem CID | 15364094 |
| Molecular Formula | C28H25Cl2NO6 |
| Molecular Weight | 542.42 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | ethyl 6-benzyl-3,3-bis(4-chlorophenyl)-7a-hydroxy-5-oxo-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate |
| SMILES | CCOC(=O)C12CC(c3ccc(Cl)cc3)(c3ccc(Cl)cc3)OOC1(O)CN(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C28H25Cl2NO6/c1-2-35-25(33)26-17-27(20-8-12-22(29)13-9-20,21-10-14-23(30)15-11-21)36-37-28(26,34)18-31(24(26)32)16-19-6-4-3-5-7-19/h3-15,34H,2,16-18H2,1H3 |
| InChIKey | ALKPXTNHMUSPSO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|