C23H24ClNO6 — CID 15364113
ethyl (4aR,7aR)-6-benzyl-3-(4-chlorophenyl)-7a-hydroxy-3-methyl-5-oxo-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate (PubChem CID 15364113) has the molecular formula C23H24ClNO6 and a molecular weight of 445.90 g/mol. Its IUPAC name is ethyl (4aR,7aR)-6-benzyl-3-(4-chlorophenyl)-7a-hydroxy-3-methyl-5-oxo-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate.
| Compound Name | ethyl (4aR,7aR)-6-benzyl-3-(4-chlorophenyl)-7a-hydroxy-3-methyl-5-oxo-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate |
|---|---|
| PubChem CID | 15364113 |
| Molecular Formula | C23H24ClNO6 |
| Molecular Weight | 445.90 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | ethyl (4aR,7aR)-6-benzyl-3-(4-chlorophenyl)-7a-hydroxy-3-methyl-5-oxo-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate |
| SMILES | CCOC(=O)[C@]12CC(C)(c3ccc(Cl)cc3)OO[C@@]1(O)CN(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C23H24ClNO6/c1-3-29-20(27)22-14-21(2,17-9-11-18(24)12-10-17)30-31-23(22,28)15-25(19(22)26)13-16-7-5-4-6-8-16/h4-12,28H,3,13-15H2,1-2H3/t21?,22-,23+/m1/s1 |
| InChIKey | OXXKLYCOYNGMRK-NRSZHQCHSA-N |
| XLogP | 3.19 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.90 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|