C30H27Cl2NO6 — CID 15364137
ethyl 3-[2-acetyloxy-2,2-bis(4-chlorophenyl)ethyl]-1-benzyl-2,4-dioxopyrrolidine-3-carboxylate (PubChem CID 15364137) has the molecular formula C30H27Cl2NO6 and a molecular weight of 568.45 g/mol. Its IUPAC name is ethyl 3-[2-acetyloxy-2,2-bis(4-chlorophenyl)ethyl]-1-benzyl-2,4-dioxopyrrolidine-3-carboxylate.
| Compound Name | ethyl 3-[2-acetyloxy-2,2-bis(4-chlorophenyl)ethyl]-1-benzyl-2,4-dioxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 15364137 |
| Molecular Formula | C30H27Cl2NO6 |
| Molecular Weight | 568.45 g/mol |
| Exact Mass | 567.12 |
| IUPAC Name | ethyl 3-[2-acetyloxy-2,2-bis(4-chlorophenyl)ethyl]-1-benzyl-2,4-dioxopyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C1(CC(OC(C)=O)(c2ccc(Cl)cc2)c2ccc(Cl)cc2)C(=O)CN(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C30H27Cl2NO6/c1-3-38-28(37)29(26(35)18-33(27(29)36)17-21-7-5-4-6-8-21)19-30(39-20(2)34,22-9-13-24(31)14-10-22)23-11-15-25(32)16-12-23/h4-16H,3,17-19H2,1-2H3 |
| InChIKey | YDNRIZVXBWLSNM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.45 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|