C14H31N4PS — CID 15364241
N-[diethylamino-[(E,4E)-4-(dimethylhydrazinylidene)but-2-en-2-yl]phosphinothioyl]-N-ethylethanamine (PubChem CID 15364241) has the molecular formula C14H31N4PS and a molecular weight of 318.47 g/mol. Its IUPAC name is N-[diethylamino-[(E,4E)-4-(dimethylhydrazinylidene)but-2-en-2-yl]phosphinothioyl]-N-ethylethanamine.
| Compound Name | N-[diethylamino-[(E,4E)-4-(dimethylhydrazinylidene)but-2-en-2-yl]phosphinothioyl]-N-ethylethanamine |
|---|---|
| PubChem CID | 15364241 |
| Molecular Formula | C14H31N4PS |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | N-[diethylamino-[(E,4E)-4-(dimethylhydrazinylidene)but-2-en-2-yl]phosphinothioyl]-N-ethylethanamine |
| SMILES | CCN(CC)P(=S)(/C(C)=C/C=N/N(C)C)N(CC)CC |
| InChI | InChI=1S/C14H31N4PS/c1-8-17(9-2)19(20,18(10-3)11-4)14(5)12-13-15-16(6)7/h12-13H,8-11H2,1-7H3/b14-12+,15-13+ |
| InChIKey | SWGAWZCBSDOLKR-QUMQEAAQSA-N |
| XLogP | 3.43 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|