C14H12N2O5 — CID 15364945
6,7-dimethoxy-2-methyl-4H-pyrrolo[3,4-b]quinoline-1,3,9-trione (PubChem CID 15364945) has the molecular formula C14H12N2O5 and a molecular weight of 288.26 g/mol. Its IUPAC name is 6,7-dimethoxy-2-methyl-4H-pyrrolo[3,4-b]quinoline-1,3,9-trione.
| Compound Name | 6,7-dimethoxy-2-methyl-4H-pyrrolo[3,4-b]quinoline-1,3,9-trione |
|---|---|
| PubChem CID | 15364945 |
| Molecular Formula | C14H12N2O5 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 6,7-dimethoxy-2-methyl-4H-pyrrolo[3,4-b]quinoline-1,3,9-trione |
| SMILES | COc1cc2[nH]c3c(c(=O)c2cc1OC)C(=O)N(C)C3=O |
| InChI | InChI=1S/C14H12N2O5/c1-16-13(18)10-11(14(16)19)15-7-5-9(21-3)8(20-2)4-6(7)12(10)17/h4-5H,1-3H3,(H,15,17) |
| InChIKey | GFBXYFWBBYEPIT-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|