C19H26O5 — CID 15366759
cis-diethyl (3S,4R)-3-benzyl-4-(hydroxymethyl)cyclopentane-1,1-dicarboxylate (PubChem CID 15366759) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is cis-diethyl (3S,4R)-3-benzyl-4-(hydroxymethyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | cis-diethyl (3S,4R)-3-benzyl-4-(hydroxymethyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 15366759 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | cis-diethyl (3S,4R)-3-benzyl-4-(hydroxymethyl)cyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@@H](CO)[C@@H](Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H26O5/c1-3-23-17(21)19(18(22)24-4-2)11-15(16(12-19)13-20)10-14-8-6-5-7-9-14/h5-9,15-16,20H,3-4,10-13H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | STZJPQYJSYMGDI-HOTGVXAUSA-N |
| XLogP | 2.36 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|